C16H25N3O3S — CID 58418271
N-[(1S)-1-[5-(hydroxycarbamoyl)-4-methylthiophen-2-yl]propyl]-1-methylpiperidine-4-carboxamide (PubChem CID 58418271) has the molecular formula C16H25N3O3S and a molecular weight of 339.46 g/mol. Its IUPAC name is N-[(1S)-1-[5-(hydroxycarbamoyl)-4-methylthiophen-2-yl]propyl]-1-methylpiperidine-4-carboxamide.
| Compound Name | N-[(1S)-1-[5-(hydroxycarbamoyl)-4-methylthiophen-2-yl]propyl]-1-methylpiperidine-4-carboxamide |
|---|---|
| PubChem CID | 58418271 |
| Molecular Formula | C16H25N3O3S |
| Molecular Weight | 339.46 g/mol |
| Exact Mass | 339.16 |
| IUPAC Name | N-[(1S)-1-[5-(hydroxycarbamoyl)-4-methylthiophen-2-yl]propyl]-1-methylpiperidine-4-carboxamide |
| SMILES | CC[C@H](NC(=O)C1CCN(C)CC1)c1cc(C)c(C(=O)NO)s1 |
| InChI | InChI=1S/C16H25N3O3S/c1-4-12(13-9-10(2)14(23-13)16(21)18-22)17-15(20)11-5-7-19(3)8-6-11/h9,11-12,22H,4-8H2,1-3H3,(H,17,20)(H,18,21)/t12-/m0/s1 |
| InChIKey | HNWYAVGLSDZRNG-LBPRGKRZSA-N |
| XLogP | 2.08 |
| TPSA | 81.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.46 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|