C13H19N3O3S — CID 58418297
3-[(1S)-1-[(2-cyclopentylacetyl)amino]ethyl]-N-hydroxy-1,2-thiazole-5-carboxamide (PubChem CID 58418297) has the molecular formula C13H19N3O3S and a molecular weight of 297.38 g/mol. Its IUPAC name is 3-[(1S)-1-[(2-cyclopentylacetyl)amino]ethyl]-N-hydroxy-1,2-thiazole-5-carboxamide.
| Compound Name | 3-[(1S)-1-[(2-cyclopentylacetyl)amino]ethyl]-N-hydroxy-1,2-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 58418297 |
| Molecular Formula | C13H19N3O3S |
| Molecular Weight | 297.38 g/mol |
| Exact Mass | 297.11 |
| IUPAC Name | 3-[(1S)-1-[(2-cyclopentylacetyl)amino]ethyl]-N-hydroxy-1,2-thiazole-5-carboxamide |
| SMILES | C[C@H](NC(=O)CC1CCCC1)c1cc(C(=O)NO)sn1 |
| InChI | InChI=1S/C13H19N3O3S/c1-8(10-7-11(20-16-10)13(18)15-19)14-12(17)6-9-4-2-3-5-9/h7-9,19H,2-6H2,1H3,(H,14,17)(H,15,18)/t8-/m0/s1 |
| InChIKey | METHWAPFLFWDCD-QMMMGPOBSA-N |
| XLogP | 2.02 |
| TPSA | 91.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.38 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|