C16H31Cl2NO4Si — CID 58418976
[dichloro(methyl)silyl]methyl 2-(4-methoxy-2,2,6,6-tetramethylpiperidin-1-yl)oxy-2-methylpropanoate (PubChem CID 58418976) has the molecular formula C16H31Cl2NO4Si and a molecular weight of 400.42 g/mol. Its IUPAC name is [dichloro(methyl)silyl]methyl 2-(4-methoxy-2,2,6,6-tetramethylpiperidin-1-yl)oxy-2-methylpropanoate.
| Compound Name | [dichloro(methyl)silyl]methyl 2-(4-methoxy-2,2,6,6-tetramethylpiperidin-1-yl)oxy-2-methylpropanoate |
|---|---|
| PubChem CID | 58418976 |
| Molecular Formula | C16H31Cl2NO4Si |
| Molecular Weight | 400.42 g/mol |
| Exact Mass | 399.14 |
| IUPAC Name | [dichloro(methyl)silyl]methyl 2-(4-methoxy-2,2,6,6-tetramethylpiperidin-1-yl)oxy-2-methylpropanoate |
| SMILES | COC1CC(C)(C)N(OC(C)(C)C(=O)OC[Si](C)(Cl)Cl)C(C)(C)C1 |
| InChI | InChI=1S/C16H31Cl2NO4Si/c1-14(2)9-12(21-7)10-15(3,4)19(14)23-16(5,6)13(20)22-11-24(8,17)18/h12H,9-11H2,1-8H3 |
| InChIKey | NMVURJJFSUGSGY-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.42 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|