C11H18F6S — CID 58419034
8,8,8-trifluoro-7,7-dimethyl-5-(trifluoromethyl)octane-1-thiol (PubChem CID 58419034) has the molecular formula C11H18F6S and a molecular weight of 296.32 g/mol. Its IUPAC name is 8,8,8-trifluoro-7,7-dimethyl-5-(trifluoromethyl)octane-1-thiol.
| Compound Name | 8,8,8-trifluoro-7,7-dimethyl-5-(trifluoromethyl)octane-1-thiol |
|---|---|
| PubChem CID | 58419034 |
| Molecular Formula | C11H18F6S |
| Molecular Weight | 296.32 g/mol |
| Exact Mass | 296.10 |
| IUPAC Name | 8,8,8-trifluoro-7,7-dimethyl-5-(trifluoromethyl)octane-1-thiol |
| SMILES | CC(C)(CC(CCCCS)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C11H18F6S/c1-9(2,11(15,16)17)7-8(10(12,13)14)5-3-4-6-18/h8,18H,3-7H2,1-2H3 |
| InChIKey | WMEPAJKTGJJKMT-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.32 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|