C18H19F17 — CID 58419035
9,9,11,11,13,14,14,14-octafluoro-13-methyl-3,5,7-tris(trifluoromethyl)tetradec-1-ene (PubChem CID 58419035) has the molecular formula C18H19F17 and a molecular weight of 558.32 g/mol. Its IUPAC name is 9,9,11,11,13,14,14,14-octafluoro-13-methyl-3,5,7-tris(trifluoromethyl)tetradec-1-ene.
| Compound Name | 9,9,11,11,13,14,14,14-octafluoro-13-methyl-3,5,7-tris(trifluoromethyl)tetradec-1-ene |
|---|---|
| PubChem CID | 58419035 |
| Molecular Formula | C18H19F17 |
| Molecular Weight | 558.32 g/mol |
| Exact Mass | 558.12 |
| IUPAC Name | 9,9,11,11,13,14,14,14-octafluoro-13-methyl-3,5,7-tris(trifluoromethyl)tetradec-1-ene |
| SMILES | C=CC(CC(CC(CC(F)(F)CC(F)(F)CC(C)(F)C(F)(F)F)C(F)(F)F)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C18H19F17/c1-3-9(15(24,25)26)4-10(16(27,28)29)5-11(17(30,31)32)6-13(20,21)8-14(22,23)7-12(2,19)18(33,34)35/h3,9-11H,1,4-8H2,2H3 |
| InChIKey | CCOQJFSIYDDILJ-UHFFFAOYSA-N |
| XLogP | 9.22 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.32 |
| LogP ≤ 5 | 9.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|