C24H36F14N2O2S — CID 58419053
N-[3-(dimethylamino)propyl]-4,4,4-trifluoro-3-[4-methyl-5-(1,1,3,3,5,6,6,6-octafluoro-5-methylhexyl)-2-(trifluoromethyl)cyclohexyl]butane-1-sulfonamide (PubChem CID 58419053) has the molecular formula C24H36F14N2O2S and a molecular weight of 682.60 g/mol. Its IUPAC name is N-[3-(dimethylamino)propyl]-4,4,4-trifluoro-3-[4-methyl-5-(1,1,3,3,5,6,6,6-octafluoro-5-methylhexyl)-2-(trifluoromethyl)cyclohexyl]butane-1-sulfonamide.
| Compound Name | N-[3-(dimethylamino)propyl]-4,4,4-trifluoro-3-[4-methyl-5-(1,1,3,3,5,6,6,6-octafluoro-5-methylhexyl)-2-(trifluoromethyl)cyclohexyl]butane-1-sulfonamide |
|---|---|
| PubChem CID | 58419053 |
| Molecular Formula | C24H36F14N2O2S |
| Molecular Weight | 682.60 g/mol |
| Exact Mass | 682.23 |
| IUPAC Name | N-[3-(dimethylamino)propyl]-4,4,4-trifluoro-3-[4-methyl-5-(1,1,3,3,5,6,6,6-octafluoro-5-methylhexyl)-2-(trifluoromethyl)cyclohexyl]butane-1-sulfonamide |
| SMILES | CC1CC(C(F)(F)F)C(C(CCS(=O)(=O)NCCCN(C)C)C(F)(F)F)CC1C(F)(F)CC(F)(F)CC(C)(F)C(F)(F)F |
| InChI | InChI=1S/C24H36F14N2O2S/c1-14-10-18(23(33,34)35)15(16(22(30,31)32)6-9-43(41,42)39-7-5-8-40(3)4)11-17(14)21(28,29)13-20(26,27)12-19(2,25)24(36,37)38/h14-18,39H,5-13H2,1-4H3 |
| InChIKey | PLDLKAGVXASOHH-UHFFFAOYSA-N |
| XLogP | 7.61 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 682.60 |
| LogP ≤ 5 | 7.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|