C11H16F8S — CID 58419084
1,8,9,9,9-pentafluoro-8-methyl-4-(trifluoromethyl)nonane-1-thiol (PubChem CID 58419084) has the molecular formula C11H16F8S and a molecular weight of 332.30 g/mol. Its IUPAC name is 1,8,9,9,9-pentafluoro-8-methyl-4-(trifluoromethyl)nonane-1-thiol.
| Compound Name | 1,8,9,9,9-pentafluoro-8-methyl-4-(trifluoromethyl)nonane-1-thiol |
|---|---|
| PubChem CID | 58419084 |
| Molecular Formula | C11H16F8S |
| Molecular Weight | 332.30 g/mol |
| Exact Mass | 332.08 |
| IUPAC Name | 1,8,9,9,9-pentafluoro-8-methyl-4-(trifluoromethyl)nonane-1-thiol |
| SMILES | CC(F)(CCCC(CCC(F)S)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C11H16F8S/c1-9(13,11(17,18)19)6-2-3-7(10(14,15)16)4-5-8(12)20/h7-8,20H,2-6H2,1H3 |
| InChIKey | BRWWPIMAYOFYSE-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.30 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|