C22H10Br2N4O2 — CID 58419159
9,19-dibromo-13-isocyano-7,17-dioxo-6,16-diazahexacyclo[9.9.2.02,6.08,21.012,16.018,22]docosa-1(20),2,8,10,12,18,21-heptaene-3-carbonitrile (PubChem CID 58419159) has the molecular formula C22H10Br2N4O2 and a molecular weight of 522.16 g/mol. Its IUPAC name is 9,19-dibromo-13-isocyano-7,17-dioxo-6,16-diazahexacyclo[9.9.2.02,6.08,21.012,16.018,22]docosa-1(20),2,8,10,12,18,21-heptaene-3-carbonitrile.
| Compound Name | 9,19-dibromo-13-isocyano-7,17-dioxo-6,16-diazahexacyclo[9.9.2.02,6.08,21.012,16.018,22]docosa-1(20),2,8,10,12,18,21-heptaene-3-carbonitrile |
|---|---|
| PubChem CID | 58419159 |
| Molecular Formula | C22H10Br2N4O2 |
| Molecular Weight | 522.16 g/mol |
| Exact Mass | 519.92 |
| IUPAC Name | 9,19-dibromo-13-isocyano-7,17-dioxo-6,16-diazahexacyclo[9.9.2.02,6.08,21.012,16.018,22]docosa-1(20),2,8,10,12,18,21-heptaene-3-carbonitrile |
| SMILES | [C-]#[N+]C1=c2c3cc(Br)c4c(=O)n5c(c6cc(Br)c(c(=O)n2CC1)c3c64)=C(C#N)CC5 |
| InChI | InChI=1S/C22H10Br2N4O2/c1-26-14-3-5-28-20(14)11-7-13(24)17-15-10(6-12(23)18(16(11)15)22(28)30)19-9(8-25)2-4-27(19)21(17)29/h6-7H,2-5H2 |
| InChIKey | LDBOVONPJRKPOM-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 72.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.16 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|