C26H18F16O5 — CID 58419184
1-[3-acetyl-5-[1,1,2-trifluoro-2-[1,1,2,3,3,3-hexafluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)propoxy]ethoxy]phenyl]-2-(3-ethylphenyl)ethanone (PubChem CID 58419184) has the molecular formula C26H18F16O5 and a molecular weight of 714.39 g/mol. Its IUPAC name is 1-[3-acetyl-5-[1,1,2-trifluoro-2-[1,1,2,3,3,3-hexafluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)propoxy]ethoxy]phenyl]-2-(3-ethylphenyl)ethanone.
| Compound Name | 1-[3-acetyl-5-[1,1,2-trifluoro-2-[1,1,2,3,3,3-hexafluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)propoxy]ethoxy]phenyl]-2-(3-ethylphenyl)ethanone |
|---|---|
| PubChem CID | 58419184 |
| Molecular Formula | C26H18F16O5 |
| Molecular Weight | 714.39 g/mol |
| Exact Mass | 714.09 |
| IUPAC Name | 1-[3-acetyl-5-[1,1,2-trifluoro-2-[1,1,2,3,3,3-hexafluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)propoxy]ethoxy]phenyl]-2-(3-ethylphenyl)ethanone |
| SMILES | CCc1cccc(CC(=O)c2cc(OC(F)(F)C(F)OC(F)(F)C(F)(OC(F)(F)C(F)(F)C(F)(F)F)C(F)(F)F)cc(C(C)=O)c2)c1 |
| InChI | InChI=1S/C26H18F16O5/c1-3-13-5-4-6-14(7-13)8-18(44)16-9-15(12(2)43)10-17(11-16)45-20(28,29)19(27)46-26(41,42)22(32,24(36,37)38)47-25(39,40)21(30,31)23(33,34)35/h4-7,9-11,19H,3,8H2,1-2H3 |
| InChIKey | YOGFSSWSXPSXJS-UHFFFAOYSA-N |
| XLogP | 8.79 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 714.39 |
| LogP ≤ 5 | 8.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|