About 3H-indol-2-ylmethanol
3H-indol-2-ylmethanol (PubChem CID 58419350) has the molecular formula C9H9NO
and a molecular weight of 147.18 g/mol. Its IUPAC name is 3H-indol-2-ylmethanol.
Molecular Properties
| Compound Name | 3H-indol-2-ylmethanol |
| PubChem CID | 58419350 |
| Molecular Formula | C9H9NO |
| Molecular Weight | 147.18 g/mol |
| Exact Mass | 147.07 |
| IUPAC Name | 3H-indol-2-ylmethanol |
| SMILES | OCC1=Nc2ccccc2C1 |
| InChI | InChI=1S/C9H9NO/c11-6-8-5-7-3-1-2-4-9(7)10-8/h1-4,11H,5-6H2 |
| InChIKey | SQDNBZOWKVBSAS-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 32.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 147.18 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3H-indol-2-ylmethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3H-indol-2-ylmethanol?
The IUPAC name of 3H-indol-2-ylmethanol (CID 58419350) is 3H-indol-2-ylmethanol.
What is the SMILES notation for 3H-indol-2-ylmethanol?
The canonical SMILES for 3H-indol-2-ylmethanol is OCC1=Nc2ccccc2C1.
What is the InChIKey of 3H-indol-2-ylmethanol?
The InChIKey is SQDNBZOWKVBSAS-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9NO/c11-6-8-5-7-3-1-2-4-9(7)10-8/h1-4,11H,5-6H2.
What are the key properties of 3H-indol-2-ylmethanol?
3H-indol-2-ylmethanol has a molecular weight of 147.18 g/mol, XLogP of 1.31, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3H-indol-2-ylmethanol is sourced from PubChem (CID 58419350), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).