About [(Z,2S)-5-[tert-butyl(dimethyl)silyl]oxypent-3-en-2-yl] propanoate
[(Z,2S)-5-[tert-butyl(dimethyl)silyl]oxypent-3-en-2-yl] propanoate (PubChem CID 58419839) has the molecular formula C14H28O3Si
and a molecular weight of 272.46 g/mol. Its IUPAC name is [(Z,2S)-5-[tert-butyl(dimethyl)silyl]oxypent-3-en-2-yl] propanoate.
Molecular Properties
| Compound Name | [(Z,2S)-5-[tert-butyl(dimethyl)silyl]oxypent-3-en-2-yl] propanoate |
| PubChem CID | 58419839 |
| Molecular Formula | C14H28O3Si |
| Molecular Weight | 272.46 g/mol |
| Exact Mass | 272.18 |
| IUPAC Name | [(Z,2S)-5-[tert-butyl(dimethyl)silyl]oxypent-3-en-2-yl] propanoate |
| SMILES | CCC(=O)O[C@@H](C)/C=C\CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C14H28O3Si/c1-8-13(15)17-12(2)10-9-11-16-18(6,7)14(3,4)5/h9-10,12H,8,11H2,1-7H3/b10-9-/t12-/m0/s1 |
| InChIKey | CBXCZGDNELCKMN-PRDAAYKISA-N |
| XLogP | 3.91 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 272.46 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze [(Z,2S)-5-[tert-butyl(dimethyl)silyl]oxypent-3-en-2-yl] propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(Z,2S)-5-[tert-butyl(dimethyl)silyl]oxypent-3-en-2-yl] propanoate?
The IUPAC name of [(Z,2S)-5-[tert-butyl(dimethyl)silyl]oxypent-3-en-2-yl] propanoate (CID 58419839) is [(Z,2S)-5-[tert-butyl(dimethyl)silyl]oxypent-3-en-2-yl] propanoate.
What is the SMILES notation for [(Z,2S)-5-[tert-butyl(dimethyl)silyl]oxypent-3-en-2-yl] propanoate?
The canonical SMILES for [(Z,2S)-5-[tert-butyl(dimethyl)silyl]oxypent-3-en-2-yl] propanoate is CCC(=O)O[C@@H](C)/C=C\CO[Si](C)(C)C(C)(C)C.
What is the InChIKey of [(Z,2S)-5-[tert-butyl(dimethyl)silyl]oxypent-3-en-2-yl] propanoate?
The InChIKey is CBXCZGDNELCKMN-PRDAAYKISA-N. The full InChI is InChI=1S/C14H28O3Si/c1-8-13(15)17-12(2)10-9-11-16-18(6,7)14(3,4)5/h9-10,12H,8,11H2,1-7H3/b10-9-/t12-/m0/s1.
What are the key properties of [(Z,2S)-5-[tert-butyl(dimethyl)silyl]oxypent-3-en-2-yl] propanoate?
[(Z,2S)-5-[tert-butyl(dimethyl)silyl]oxypent-3-en-2-yl] propanoate has a molecular weight of 272.46 g/mol, XLogP of 3.91, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [(Z,2S)-5-[tert-butyl(dimethyl)silyl]oxypent-3-en-2-yl] propanoate is sourced from PubChem (CID 58419839), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).