About (2R)-1-N,1-N-dimethyl-3-methylsulfonylpropane-1,2-diamine
(2R)-1-N,1-N-dimethyl-3-methylsulfonylpropane-1,2-diamine (PubChem CID 58419914) has the molecular formula C6H16N2O2S
and a molecular weight of 180.27 g/mol. Its IUPAC name is (2R)-1-N,1-N-dimethyl-3-methylsulfonylpropane-1,2-diamine.
Molecular Properties
| Compound Name | (2R)-1-N,1-N-dimethyl-3-methylsulfonylpropane-1,2-diamine |
| PubChem CID | 58419914 |
| Molecular Formula | C6H16N2O2S |
| Molecular Weight | 180.27 g/mol |
| Exact Mass | 180.09 |
| IUPAC Name | (2R)-1-N,1-N-dimethyl-3-methylsulfonylpropane-1,2-diamine |
| SMILES | CN(C)C[C@@H](N)CS(C)(=O)=O |
| InChI | InChI=1S/C6H16N2O2S/c1-8(2)4-6(7)5-11(3,9)10/h6H,4-5,7H2,1-3H3/t6-/m1/s1 |
| InChIKey | UQGCADPYHQYJDS-ZCFIWIBFSA-N |
| XLogP | -1.08 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 180.27 |
| LogP ≤ 5 | -1.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (2R)-1-N,1-N-dimethyl-3-methylsulfonylpropane-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-1-N,1-N-dimethyl-3-methylsulfonylpropane-1,2-diamine?
The IUPAC name of (2R)-1-N,1-N-dimethyl-3-methylsulfonylpropane-1,2-diamine (CID 58419914) is (2R)-1-N,1-N-dimethyl-3-methylsulfonylpropane-1,2-diamine.
What is the SMILES notation for (2R)-1-N,1-N-dimethyl-3-methylsulfonylpropane-1,2-diamine?
The canonical SMILES for (2R)-1-N,1-N-dimethyl-3-methylsulfonylpropane-1,2-diamine is CN(C)C[C@@H](N)CS(C)(=O)=O.
What is the InChIKey of (2R)-1-N,1-N-dimethyl-3-methylsulfonylpropane-1,2-diamine?
The InChIKey is UQGCADPYHQYJDS-ZCFIWIBFSA-N. The full InChI is InChI=1S/C6H16N2O2S/c1-8(2)4-6(7)5-11(3,9)10/h6H,4-5,7H2,1-3H3/t6-/m1/s1.
What are the key properties of (2R)-1-N,1-N-dimethyl-3-methylsulfonylpropane-1,2-diamine?
(2R)-1-N,1-N-dimethyl-3-methylsulfonylpropane-1,2-diamine has a molecular weight of 180.27 g/mol, XLogP of -1.08, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-1-N,1-N-dimethyl-3-methylsulfonylpropane-1,2-diamine is sourced from PubChem (CID 58419914), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).