C10H12N2O3 — CID 5842
5,5-bis(prop-2-enyl)-1,3-diazinane-2,4,6-trione (PubChem CID 5842) has the molecular formula C10H12N2O3 and a molecular weight of 208.22 g/mol. Its IUPAC name is 5,5-bis(prop-2-enyl)-1,3-diazinane-2,4,6-trione.
| Compound Name | 5,5-bis(prop-2-enyl)-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 5842 |
| Molecular Formula | C10H12N2O3 |
| Molecular Weight | 208.22 g/mol |
| Exact Mass | 208.08 |
| IUPAC Name | 5,5-bis(prop-2-enyl)-1,3-diazinane-2,4,6-trione |
| SMILES | C=CCC1(CC=C)C(=O)NC(=O)NC1=O |
| InChI | InChI=1S/C10H12N2O3/c1-3-5-10(6-4-2)7(13)11-9(15)12-8(10)14/h3-4H,1-2,5-6H2,(H2,11,12,13,14,15) |
| InChIKey | FDQGNLOWMMVRQL-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.22 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|