About phenacyl 2-(methylamino)benzoate
phenacyl 2-(methylamino)benzoate (PubChem CID 584201) has the molecular formula C16H15NO3
and a molecular weight of 269.30 g/mol. Its IUPAC name is phenacyl 2-(methylamino)benzoate.
Molecular Properties
| Compound Name | phenacyl 2-(methylamino)benzoate |
| PubChem CID | 584201 |
| Molecular Formula | C16H15NO3 |
| Molecular Weight | 269.30 g/mol |
| Exact Mass | 269.11 |
| IUPAC Name | phenacyl 2-(methylamino)benzoate |
| SMILES | CNc1ccccc1C(=O)OCC(=O)c1ccccc1 |
| InChI | InChI=1S/C16H15NO3/c1-17-14-10-6-5-9-13(14)16(19)20-11-15(18)12-7-3-2-4-8-12/h2-10,17H,11H2,1H3 |
| InChIKey | HHVOQLJCZOXOHF-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 269.30 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze phenacyl 2-(methylamino)benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of phenacyl 2-(methylamino)benzoate?
The IUPAC name of phenacyl 2-(methylamino)benzoate (CID 584201) is phenacyl 2-(methylamino)benzoate.
What is the SMILES notation for phenacyl 2-(methylamino)benzoate?
The canonical SMILES for phenacyl 2-(methylamino)benzoate is CNc1ccccc1C(=O)OCC(=O)c1ccccc1.
What is the InChIKey of phenacyl 2-(methylamino)benzoate?
The InChIKey is HHVOQLJCZOXOHF-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H15NO3/c1-17-14-10-6-5-9-13(14)16(19)20-11-15(18)12-7-3-2-4-8-12/h2-10,17H,11H2,1H3.
What are the key properties of phenacyl 2-(methylamino)benzoate?
phenacyl 2-(methylamino)benzoate has a molecular weight of 269.30 g/mol, XLogP of 2.77, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for phenacyl 2-(methylamino)benzoate is sourced from PubChem (CID 584201), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).