C8H8BrFO2 — CID 58420229
1-bromo-4-fluoro-2,3-dimethoxybenzene (PubChem CID 58420229) has the molecular formula C8H8BrFO2 and a molecular weight of 235.05 g/mol. Its IUPAC name is 1-bromo-4-fluoro-2,3-dimethoxybenzene.
| Compound Name | 1-bromo-4-fluoro-2,3-dimethoxybenzene |
|---|---|
| PubChem CID | 58420229 |
| Molecular Formula | C8H8BrFO2 |
| Molecular Weight | 235.05 g/mol |
| Exact Mass | 233.97 |
| IUPAC Name | 1-bromo-4-fluoro-2,3-dimethoxybenzene |
| SMILES | COc1c(F)ccc(Br)c1OC |
| InChI | InChI=1S/C8H8BrFO2/c1-11-7-5(9)3-4-6(10)8(7)12-2/h3-4H,1-2H3 |
| InChIKey | XPGWYBFHCGAIRS-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.05 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |