C19H22O4 — CID 58420543
4-[2-[4,5-di(propan-2-yl)furan-2-yl]-2-oxoethyl]benzoic acid (PubChem CID 58420543) has the molecular formula C19H22O4 and a molecular weight of 314.38 g/mol. Its IUPAC name is 4-[2-[4,5-di(propan-2-yl)furan-2-yl]-2-oxoethyl]benzoic acid.
| Compound Name | 4-[2-[4,5-di(propan-2-yl)furan-2-yl]-2-oxoethyl]benzoic acid |
|---|---|
| PubChem CID | 58420543 |
| Molecular Formula | C19H22O4 |
| Molecular Weight | 314.38 g/mol |
| Exact Mass | 314.15 |
| IUPAC Name | 4-[2-[4,5-di(propan-2-yl)furan-2-yl]-2-oxoethyl]benzoic acid |
| SMILES | CC(C)c1cc(C(=O)Cc2ccc(C(=O)O)cc2)oc1C(C)C |
| InChI | InChI=1S/C19H22O4/c1-11(2)15-10-17(23-18(15)12(3)4)16(20)9-13-5-7-14(8-6-13)19(21)22/h5-8,10-12H,9H2,1-4H3,(H,21,22) |
| InChIKey | KJTSPXIFQUCZBU-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 67.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.38 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |