C22H22O3 — CID 58420581
4-[2-(5,6,6a,7,8,9-hexahydro-4H-phenalen-2-yl)acetyl]benzoic acid (PubChem CID 58420581) has the molecular formula C22H22O3 and a molecular weight of 334.42 g/mol. Its IUPAC name is 4-[2-(5,6,6a,7,8,9-hexahydro-4H-phenalen-2-yl)acetyl]benzoic acid.
| Compound Name | 4-[2-(5,6,6a,7,8,9-hexahydro-4H-phenalen-2-yl)acetyl]benzoic acid |
|---|---|
| PubChem CID | 58420581 |
| Molecular Formula | C22H22O3 |
| Molecular Weight | 334.42 g/mol |
| Exact Mass | 334.16 |
| IUPAC Name | 4-[2-(5,6,6a,7,8,9-hexahydro-4H-phenalen-2-yl)acetyl]benzoic acid |
| SMILES | O=C(O)c1ccc(C(=O)Cc2cc3c4c(c2)CCCC4CCC3)cc1 |
| InChI | InChI=1S/C22H22O3/c23-20(15-7-9-17(10-8-15)22(24)25)13-14-11-18-5-1-3-16-4-2-6-19(12-14)21(16)18/h7-12,16H,1-6,13H2,(H,24,25) |
| InChIKey | VYNZKVNCCQYIFU-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.42 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |