C30H15N3S3 — CID 58420678
6,18,30-trithia-9,21,33-triazadecacyclo[24.10.0.02,13.03,7.08,12.014,25.015,19.020,24.027,31.032,36]hexatriaconta-1(36),2,4,7,10,12,14,16,19,22,24,26,28,31,34-pentadecaene (PubChem CID 58420678) has the molecular formula C30H15N3S3 and a molecular weight of 513.67 g/mol. Its IUPAC name is 6,18,30-trithia-9,21,33-triazadecacyclo[24.10.0.02,13.03,7.08,12.014,25.015,19.020,24.027,31.032,36]hexatriaconta-1(36),2,4,7,10,12,14,16,19,22,24,26,28,31,34-pentadecaene.
| Compound Name | 6,18,30-trithia-9,21,33-triazadecacyclo[24.10.0.02,13.03,7.08,12.014,25.015,19.020,24.027,31.032,36]hexatriaconta-1(36),2,4,7,10,12,14,16,19,22,24,26,28,31,34-pentadecaene |
|---|---|
| PubChem CID | 58420678 |
| Molecular Formula | C30H15N3S3 |
| Molecular Weight | 513.67 g/mol |
| Exact Mass | 513.04 |
| IUPAC Name | 6,18,30-trithia-9,21,33-triazadecacyclo[24.10.0.02,13.03,7.08,12.014,25.015,19.020,24.027,31.032,36]hexatriaconta-1(36),2,4,7,10,12,14,16,19,22,24,26,28,31,34-pentadecaene |
| SMILES | c1cc2c([nH]1)c1sccc1c1c3c4cc[nH]c4c4sccc4c3c3c4cc[nH]c4c4sccc4c3c21 |
| InChI | InChI=1S/C30H15N3S3/c1-7-31-25-13(1)19-22(16-4-10-34-28(16)25)20-14-2-9-33-27(14)30-18(6-12-36-30)24(20)21-15-3-8-32-26(15)29-17(23(19)21)5-11-35-29/h1-12,31-33H |
| InChIKey | GJTWXZBQVQNCLW-UHFFFAOYSA-N |
| XLogP | 10.23 |
| TPSA | 47.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.67 |
| LogP ≤ 5 | 10.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|