C7H8F6O3 — CID 58420747
2-(1,1,2,3,3,3-hexafluoropropoxymethyl)-1,3-dioxolane (PubChem CID 58420747) has the molecular formula C7H8F6O3 and a molecular weight of 254.13 g/mol. Its IUPAC name is 2-(1,1,2,3,3,3-hexafluoropropoxymethyl)-1,3-dioxolane.
| Compound Name | 2-(1,1,2,3,3,3-hexafluoropropoxymethyl)-1,3-dioxolane |
|---|---|
| PubChem CID | 58420747 |
| Molecular Formula | C7H8F6O3 |
| Molecular Weight | 254.13 g/mol |
| Exact Mass | 254.04 |
| IUPAC Name | 2-(1,1,2,3,3,3-hexafluoropropoxymethyl)-1,3-dioxolane |
| SMILES | FC(C(F)(F)F)C(F)(F)OCC1OCCO1 |
| InChI | InChI=1S/C7H8F6O3/c8-5(6(9,10)11)7(12,13)16-3-4-14-1-2-15-4/h4-5H,1-3H2 |
| InChIKey | WZOXQAYAQINCNB-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.13 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |