About iridium;2-methyl-6-phenylpyridine;2-(2-phenyl-4-pyridinyl)quinoline
iridium;2-methyl-6-phenylpyridine;2-(2-phenyl-4-pyridinyl)quinoline (PubChem CID 58421059) has the molecular formula C32H23IrN3-2
and a molecular weight of 641.77 g/mol. Its IUPAC name is iridium;2-methyl-6-phenylpyridine;2-(2-phenyl-4-pyridinyl)quinoline.
Molecular Properties
| Compound Name | iridium;2-methyl-6-phenylpyridine;2-(2-phenyl-4-pyridinyl)quinoline |
| PubChem CID | 58421059 |
| Molecular Formula | C32H23IrN3-2 |
| Molecular Weight | 641.77 g/mol |
| Exact Mass | 642.15 |
| IUPAC Name | iridium;2-methyl-6-phenylpyridine;2-(2-phenyl-4-pyridinyl)quinoline |
| SMILES | Cc1cccc(-c2[c-]cccc2)n1.[Ir].[c-]1ccccc1-c1cc(-c2ccc3ccccc3n2)ccn1 |
| InChI | InChI=1S/C20H13N2.C12H10N.Ir/c1-2-6-15(7-3-1)20-14-17(12-13-21-20)19-11-10-16-8-4-5-9-18(16)22-19;1-10-6-5-9-12(13-10)11-7-3-2-4-8-11;/h1-6,8-14H;2-7,9H,1H3;/q2*-1; |
| InChIKey | WPEMXJQRJOWHGP-UHFFFAOYSA-N |
| XLogP | 7.62 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 641.77 |
| LogP ≤ 5 | 7.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze iridium;2-methyl-6-phenylpyridine;2-(2-phenyl-4-pyridinyl)quinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of iridium;2-methyl-6-phenylpyridine;2-(2-phenyl-4-pyridinyl)quinoline?
The IUPAC name of iridium;2-methyl-6-phenylpyridine;2-(2-phenyl-4-pyridinyl)quinoline (CID 58421059) is iridium;2-methyl-6-phenylpyridine;2-(2-phenyl-4-pyridinyl)quinoline.
What is the SMILES notation for iridium;2-methyl-6-phenylpyridine;2-(2-phenyl-4-pyridinyl)quinoline?
The canonical SMILES for iridium;2-methyl-6-phenylpyridine;2-(2-phenyl-4-pyridinyl)quinoline is Cc1cccc(-c2[c-]cccc2)n1.[Ir].[c-]1ccccc1-c1cc(-c2ccc3ccccc3n2)ccn1.
What is the InChIKey of iridium;2-methyl-6-phenylpyridine;2-(2-phenyl-4-pyridinyl)quinoline?
The InChIKey is WPEMXJQRJOWHGP-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H13N2.C12H10N.Ir/c1-2-6-15(7-3-1)20-14-17(12-13-21-20)19-11-10-16-8-4-5-9-18(16)22-19;1-10-6-5-9-12(13-10)11-7-3-2-4-8-11;/h1-6,8-14H;2-7,9H,1H3;/q2*-1;.
What are the key properties of iridium;2-methyl-6-phenylpyridine;2-(2-phenyl-4-pyridinyl)quinoline?
iridium;2-methyl-6-phenylpyridine;2-(2-phenyl-4-pyridinyl)quinoline has a molecular weight of 641.77 g/mol, XLogP of 7.62, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for iridium;2-methyl-6-phenylpyridine;2-(2-phenyl-4-pyridinyl)quinoline is sourced from PubChem (CID 58421059), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).