C16H23NO2 — CID 58421256
(4aR,10bR)-9-methyl-4-propyl-2,3,4a,5,6,10b-hexahydrobenzo[h][1,4]benzoxazin-3-ol (PubChem CID 58421256) has the molecular formula C16H23NO2 and a molecular weight of 261.36 g/mol. Its IUPAC name is (4aR,10bR)-9-methyl-4-propyl-2,3,4a,5,6,10b-hexahydrobenzo[h][1,4]benzoxazin-3-ol.
| Compound Name | (4aR,10bR)-9-methyl-4-propyl-2,3,4a,5,6,10b-hexahydrobenzo[h][1,4]benzoxazin-3-ol |
|---|---|
| PubChem CID | 58421256 |
| Molecular Formula | C16H23NO2 |
| Molecular Weight | 261.36 g/mol |
| Exact Mass | 261.17 |
| IUPAC Name | (4aR,10bR)-9-methyl-4-propyl-2,3,4a,5,6,10b-hexahydrobenzo[h][1,4]benzoxazin-3-ol |
| SMILES | CCCN1C(O)CO[C@@H]2c3cc(C)ccc3CC[C@H]21 |
| InChI | InChI=1S/C16H23NO2/c1-3-8-17-14-7-6-12-5-4-11(2)9-13(12)16(14)19-10-15(17)18/h4-5,9,14-16,18H,3,6-8,10H2,1-2H3/t14-,15?,16-/m1/s1 |
| InChIKey | KJWSLRQNCRRPSK-YTPLPTRZSA-N |
| XLogP | 2.41 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.36 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |