About tert-butyl-[(1S,3R)-3-(5-fluoro-2-nitrophenoxy)cyclohexyl]oxy-dimethylsilane
tert-butyl-[(1S,3R)-3-(5-fluoro-2-nitrophenoxy)cyclohexyl]oxy-dimethylsilane (PubChem CID 58421666) has the molecular formula C18H28FNO4Si
and a molecular weight of 369.51 g/mol. Its IUPAC name is tert-butyl-[(1S,3R)-3-(5-fluoro-2-nitrophenoxy)cyclohexyl]oxy-dimethylsilane.
Molecular Properties
| Compound Name | tert-butyl-[(1S,3R)-3-(5-fluoro-2-nitrophenoxy)cyclohexyl]oxy-dimethylsilane |
| PubChem CID | 58421666 |
| Molecular Formula | C18H28FNO4Si |
| Molecular Weight | 369.51 g/mol |
| Exact Mass | 369.18 |
| IUPAC Name | tert-butyl-[(1S,3R)-3-(5-fluoro-2-nitrophenoxy)cyclohexyl]oxy-dimethylsilane |
| SMILES | CC(C)(C)[Si](C)(C)O[C@H]1CCC[C@@H](Oc2cc(F)ccc2[N+](=O)[O-])C1 |
| InChI | InChI=1S/C18H28FNO4Si/c1-18(2,3)25(4,5)24-15-8-6-7-14(12-15)23-17-11-13(19)9-10-16(17)20(21)22/h9-11,14-15H,6-8,12H2,1-5H3/t14-,15+/m1/s1 |
| InChIKey | MPFORPDANFHPFH-CABCVRRESA-N |
| XLogP | 5.45 |
| TPSA | 61.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 369.51 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl-[(1S,3R)-3-(5-fluoro-2-nitrophenoxy)cyclohexyl]oxy-dimethylsilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl-[(1S,3R)-3-(5-fluoro-2-nitrophenoxy)cyclohexyl]oxy-dimethylsilane?
The IUPAC name of tert-butyl-[(1S,3R)-3-(5-fluoro-2-nitrophenoxy)cyclohexyl]oxy-dimethylsilane (CID 58421666) is tert-butyl-[(1S,3R)-3-(5-fluoro-2-nitrophenoxy)cyclohexyl]oxy-dimethylsilane.
What is the SMILES notation for tert-butyl-[(1S,3R)-3-(5-fluoro-2-nitrophenoxy)cyclohexyl]oxy-dimethylsilane?
The canonical SMILES for tert-butyl-[(1S,3R)-3-(5-fluoro-2-nitrophenoxy)cyclohexyl]oxy-dimethylsilane is CC(C)(C)[Si](C)(C)O[C@H]1CCC[C@@H](Oc2cc(F)ccc2[N+](=O)[O-])C1.
What is the InChIKey of tert-butyl-[(1S,3R)-3-(5-fluoro-2-nitrophenoxy)cyclohexyl]oxy-dimethylsilane?
The InChIKey is MPFORPDANFHPFH-CABCVRRESA-N. The full InChI is InChI=1S/C18H28FNO4Si/c1-18(2,3)25(4,5)24-15-8-6-7-14(12-15)23-17-11-13(19)9-10-16(17)20(21)22/h9-11,14-15H,6-8,12H2,1-5H3/t14-,15+/m1/s1.
What are the key properties of tert-butyl-[(1S,3R)-3-(5-fluoro-2-nitrophenoxy)cyclohexyl]oxy-dimethylsilane?
tert-butyl-[(1S,3R)-3-(5-fluoro-2-nitrophenoxy)cyclohexyl]oxy-dimethylsilane has a molecular weight of 369.51 g/mol, XLogP of 5.45, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl-[(1S,3R)-3-(5-fluoro-2-nitrophenoxy)cyclohexyl]oxy-dimethylsilane is sourced from PubChem (CID 58421666), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).