C32H16F8N2O5 — CID 58422091
2-[4-(2,4-dimethylphenyl)-3-(trifluoromethyl)phenyl]-6-methyl-8-(2,3,4,5,6-pentafluorophenoxy)pyrrolo[3,4-f]isoindole-1,3,5,7-tetrone (PubChem CID 58422091) has the molecular formula C32H16F8N2O5 and a molecular weight of 660.47 g/mol. Its IUPAC name is 2-[4-(2,4-dimethylphenyl)-3-(trifluoromethyl)phenyl]-6-methyl-8-(2,3,4,5,6-pentafluorophenoxy)pyrrolo[3,4-f]isoindole-1,3,5,7-tetrone.
| Compound Name | 2-[4-(2,4-dimethylphenyl)-3-(trifluoromethyl)phenyl]-6-methyl-8-(2,3,4,5,6-pentafluorophenoxy)pyrrolo[3,4-f]isoindole-1,3,5,7-tetrone |
|---|---|
| PubChem CID | 58422091 |
| Molecular Formula | C32H16F8N2O5 |
| Molecular Weight | 660.47 g/mol |
| Exact Mass | 660.09 |
| IUPAC Name | 2-[4-(2,4-dimethylphenyl)-3-(trifluoromethyl)phenyl]-6-methyl-8-(2,3,4,5,6-pentafluorophenoxy)pyrrolo[3,4-f]isoindole-1,3,5,7-tetrone |
| SMILES | Cc1ccc(-c2ccc(-n3c(=O)c4cc5c(=O)n(C)c(=O)c5c(Oc5c(F)c(F)c(F)c(F)c5F)c4c3=O)cc2C(F)(F)F)c(C)c1 |
| InChI | InChI=1S/C32H16F8N2O5/c1-11-4-6-14(12(2)8-11)15-7-5-13(9-18(15)32(38,39)40)42-29(44)17-10-16-19(30(45)41(3)28(16)43)26(20(17)31(42)46)47-27-24(36)22(34)21(33)23(35)25(27)37/h4-10H,1-3H3 |
| InChIKey | YATUYJHLJSCPKL-UHFFFAOYSA-N |
| XLogP | 6.23 |
| TPSA | 87.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 660.47 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|