C38H15F13N2O6 — CID 58422098
2-[4-(2,4-dimethylphenyl)-3-(trifluoromethyl)phenyl]-6-methyl-4,8-bis(2,3,4,5,6-pentafluorophenoxy)pyrrolo[3,4-f]isoindole-1,3,5,7-tetrone (PubChem CID 58422098) has the molecular formula C38H15F13N2O6 and a molecular weight of 842.52 g/mol. Its IUPAC name is 2-[4-(2,4-dimethylphenyl)-3-(trifluoromethyl)phenyl]-6-methyl-4,8-bis(2,3,4,5,6-pentafluorophenoxy)pyrrolo[3,4-f]isoindole-1,3,5,7-tetrone.
| Compound Name | 2-[4-(2,4-dimethylphenyl)-3-(trifluoromethyl)phenyl]-6-methyl-4,8-bis(2,3,4,5,6-pentafluorophenoxy)pyrrolo[3,4-f]isoindole-1,3,5,7-tetrone |
|---|---|
| PubChem CID | 58422098 |
| Molecular Formula | C38H15F13N2O6 |
| Molecular Weight | 842.52 g/mol |
| Exact Mass | 842.07 |
| IUPAC Name | 2-[4-(2,4-dimethylphenyl)-3-(trifluoromethyl)phenyl]-6-methyl-4,8-bis(2,3,4,5,6-pentafluorophenoxy)pyrrolo[3,4-f]isoindole-1,3,5,7-tetrone |
| SMILES | Cc1ccc(-c2ccc(-n3c(=O)c4c(Oc5c(F)c(F)c(F)c(F)c5F)c5c(=O)n(C)c(=O)c5c(Oc5c(F)c(F)c(F)c(F)c5F)c4c3=O)cc2C(F)(F)F)c(C)c1 |
| InChI | InChI=1S/C38H15F13N2O6/c1-10-4-6-13(11(2)8-10)14-7-5-12(9-15(14)38(49,50)51)53-36(56)18-19(37(53)57)31(59-33-28(47)24(43)21(40)25(44)29(33)48)17-16(34(54)52(3)35(17)55)30(18)58-32-26(45)22(41)20(39)23(42)27(32)46/h4-9H,1-3H3 |
| InChIKey | PGTZFMZRRXQORM-UHFFFAOYSA-N |
| XLogP | 8.72 |
| TPSA | 96.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 842.52 |
| LogP ≤ 5 | 8.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|