C26H18F4N2O2 — CID 58422112
3,10-bis(3,4-difluorophenyl)-2,4,9,11-tetrahydro-[1,3]benzoxazino[7,6-h][1,3]benzoxazine (PubChem CID 58422112) has the molecular formula C26H18F4N2O2 and a molecular weight of 466.43 g/mol. Its IUPAC name is 3,10-bis(3,4-difluorophenyl)-2,4,9,11-tetrahydro-[1,3]benzoxazino[7,6-h][1,3]benzoxazine.
| Compound Name | 3,10-bis(3,4-difluorophenyl)-2,4,9,11-tetrahydro-[1,3]benzoxazino[7,6-h][1,3]benzoxazine |
|---|---|
| PubChem CID | 58422112 |
| Molecular Formula | C26H18F4N2O2 |
| Molecular Weight | 466.43 g/mol |
| Exact Mass | 466.13 |
| IUPAC Name | 3,10-bis(3,4-difluorophenyl)-2,4,9,11-tetrahydro-[1,3]benzoxazino[7,6-h][1,3]benzoxazine |
| SMILES | Fc1ccc(N2COc3cc4ccc5c(c4cc3C2)OCN(c2ccc(F)c(F)c2)C5)cc1F |
| InChI | InChI=1S/C26H18F4N2O2/c27-21-5-3-18(9-23(21)29)31-11-16-2-1-15-8-25-17(7-20(15)26(16)34-14-31)12-32(13-33-25)19-4-6-22(28)24(30)10-19/h1-10H,11-14H2 |
| InChIKey | VAROTYKNKUVOLW-UHFFFAOYSA-N |
| XLogP | 6.11 |
| TPSA | 24.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.43 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |