C5H5ClF3O5S- — CID 58422467
3-(2-chloroacetyl)oxy-1,1,2-trifluoropropane-1-sulfonate (PubChem CID 58422467) has the molecular formula C5H5ClF3O5S- and a molecular weight of 269.60 g/mol. Its IUPAC name is 3-(2-chloroacetyl)oxy-1,1,2-trifluoropropane-1-sulfonate.
| Compound Name | 3-(2-chloroacetyl)oxy-1,1,2-trifluoropropane-1-sulfonate |
|---|---|
| PubChem CID | 58422467 |
| Molecular Formula | C5H5ClF3O5S- |
| Molecular Weight | 269.60 g/mol |
| Exact Mass | 268.95 |
| IUPAC Name | 3-(2-chloroacetyl)oxy-1,1,2-trifluoropropane-1-sulfonate |
| SMILES | O=C(CCl)OCC(F)C(F)(F)S(=O)(=O)[O-] |
| InChI | InChI=1S/C5H6ClF3O5S/c6-1-4(10)14-2-3(7)5(8,9)15(11,12)13/h3H,1-2H2,(H,11,12,13)/p-1 |
| InChIKey | VYNMNWFODGPPKT-UHFFFAOYSA-M |
| XLogP | 0.24 |
| TPSA | 83.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.60 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|