About N-(dibutyl-λ4-sulfanylidene)-2-(trifluoromethyl)-1H-benzimidazole-4-carboxamide
N-(dibutyl-λ4-sulfanylidene)-2-(trifluoromethyl)-1H-benzimidazole-4-carboxamide (PubChem CID 58422638) has the molecular formula C17H22F3N3OS
and a molecular weight of 373.44 g/mol. Its IUPAC name is N-(dibutyl-λ4-sulfanylidene)-2-(trifluoromethyl)-1H-benzimidazole-4-carboxamide.
Molecular Properties
| Compound Name | N-(dibutyl-λ4-sulfanylidene)-2-(trifluoromethyl)-1H-benzimidazole-4-carboxamide |
| PubChem CID | 58422638 |
| Molecular Formula | C17H22F3N3OS |
| Molecular Weight | 373.44 g/mol |
| Exact Mass | 373.14 |
| IUPAC Name | N-(dibutyl-λ4-sulfanylidene)-2-(trifluoromethyl)-1H-benzimidazole-4-carboxamide |
| SMILES | CCCCS(CCCC)=NC(=O)c1cccc2[nH]c(C(F)(F)F)nc12 |
| InChI | InChI=1S/C17H22F3N3OS/c1-3-5-10-25(11-6-4-2)23-15(24)12-8-7-9-13-14(12)22-16(21-13)17(18,19)20/h7-9H,3-6,10-11H2,1-2H3,(H,21,22) |
| InChIKey | VFQCTHJEBJZOQW-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 58.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 373.44 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-(dibutyl-λ4-sulfanylidene)-2-(trifluoromethyl)-1H-benzimidazole-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(dibutyl-λ4-sulfanylidene)-2-(trifluoromethyl)-1H-benzimidazole-4-carboxamide?
The IUPAC name of N-(dibutyl-λ4-sulfanylidene)-2-(trifluoromethyl)-1H-benzimidazole-4-carboxamide (CID 58422638) is N-(dibutyl-λ4-sulfanylidene)-2-(trifluoromethyl)-1H-benzimidazole-4-carboxamide.
What is the SMILES notation for N-(dibutyl-λ4-sulfanylidene)-2-(trifluoromethyl)-1H-benzimidazole-4-carboxamide?
The canonical SMILES for N-(dibutyl-λ4-sulfanylidene)-2-(trifluoromethyl)-1H-benzimidazole-4-carboxamide is CCCCS(CCCC)=NC(=O)c1cccc2[nH]c(C(F)(F)F)nc12.
What is the InChIKey of N-(dibutyl-λ4-sulfanylidene)-2-(trifluoromethyl)-1H-benzimidazole-4-carboxamide?
The InChIKey is VFQCTHJEBJZOQW-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H22F3N3OS/c1-3-5-10-25(11-6-4-2)23-15(24)12-8-7-9-13-14(12)22-16(21-13)17(18,19)20/h7-9H,3-6,10-11H2,1-2H3,(H,21,22).
What are the key properties of N-(dibutyl-λ4-sulfanylidene)-2-(trifluoromethyl)-1H-benzimidazole-4-carboxamide?
N-(dibutyl-λ4-sulfanylidene)-2-(trifluoromethyl)-1H-benzimidazole-4-carboxamide has a molecular weight of 373.44 g/mol, XLogP of 5.12, 7 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-(dibutyl-λ4-sulfanylidene)-2-(trifluoromethyl)-1H-benzimidazole-4-carboxamide is sourced from PubChem (CID 58422638), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).