C19H22O4 — CID 58422835
(2S,3R,4S,5S,6R)-2-(3-benzylphenyl)-6-methyloxane-3,4,5-triol (PubChem CID 58422835) has the molecular formula C19H22O4 and a molecular weight of 314.38 g/mol. Its IUPAC name is (2S,3R,4S,5S,6R)-2-(3-benzylphenyl)-6-methyloxane-3,4,5-triol.
| Compound Name | (2S,3R,4S,5S,6R)-2-(3-benzylphenyl)-6-methyloxane-3,4,5-triol |
|---|---|
| PubChem CID | 58422835 |
| Molecular Formula | C19H22O4 |
| Molecular Weight | 314.38 g/mol |
| Exact Mass | 314.15 |
| IUPAC Name | (2S,3R,4S,5S,6R)-2-(3-benzylphenyl)-6-methyloxane-3,4,5-triol |
| SMILES | C[C@H]1O[C@@H](c2cccc(Cc3ccccc3)c2)[C@H](O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C19H22O4/c1-12-16(20)17(21)18(22)19(23-12)15-9-5-8-14(11-15)10-13-6-3-2-4-7-13/h2-9,11-12,16-22H,10H2,1H3/t12-,16-,17+,18-,19+/m1/s1 |
| InChIKey | GEXVLXBRTBVHRM-MEOWALLASA-N |
| XLogP | 1.82 |
| TPSA | 69.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.38 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |