C16H15ClF3N3O2S — CID 58423131
(5Z)-5-[[3-chloro-2-(1,4-diazepan-1-yl)-5-(trifluoromethyl)phenyl]methylidene]-1,3-thiazolidine-2,4-dione (PubChem CID 58423131) has the molecular formula C16H15ClF3N3O2S and a molecular weight of 405.83 g/mol. Its IUPAC name is (5Z)-5-[[3-chloro-2-(1,4-diazepan-1-yl)-5-(trifluoromethyl)phenyl]methylidene]-1,3-thiazolidine-2,4-dione.
| Compound Name | (5Z)-5-[[3-chloro-2-(1,4-diazepan-1-yl)-5-(trifluoromethyl)phenyl]methylidene]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 58423131 |
| Molecular Formula | C16H15ClF3N3O2S |
| Molecular Weight | 405.83 g/mol |
| Exact Mass | 405.05 |
| IUPAC Name | (5Z)-5-[[3-chloro-2-(1,4-diazepan-1-yl)-5-(trifluoromethyl)phenyl]methylidene]-1,3-thiazolidine-2,4-dione |
| SMILES | O=C1NC(=O)/C(=C/c2cc(C(F)(F)F)cc(Cl)c2N2CCCNCC2)S1 |
| InChI | InChI=1S/C16H15ClF3N3O2S/c17-11-8-10(16(18,19)20)6-9(7-12-14(24)22-15(25)26-12)13(11)23-4-1-2-21-3-5-23/h6-8,21H,1-5H2,(H,22,24,25)/b12-7- |
| InChIKey | ZHPWHZMWMYLZQV-GHXNOFRVSA-N |
| XLogP | 3.48 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.83 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|