C22H18N2O6S — CID 58423304
(5Z)-5-[[2-[3-(1,3-dioxoisoindol-2-yl)propoxy]-5-methoxyphenyl]methylidene]-1,3-thiazolidine-2,4-dione (PubChem CID 58423304) has the molecular formula C22H18N2O6S and a molecular weight of 438.46 g/mol. Its IUPAC name is (5Z)-5-[[2-[3-(1,3-dioxoisoindol-2-yl)propoxy]-5-methoxyphenyl]methylidene]-1,3-thiazolidine-2,4-dione.
| Compound Name | (5Z)-5-[[2-[3-(1,3-dioxoisoindol-2-yl)propoxy]-5-methoxyphenyl]methylidene]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 58423304 |
| Molecular Formula | C22H18N2O6S |
| Molecular Weight | 438.46 g/mol |
| Exact Mass | 438.09 |
| IUPAC Name | (5Z)-5-[[2-[3-(1,3-dioxoisoindol-2-yl)propoxy]-5-methoxyphenyl]methylidene]-1,3-thiazolidine-2,4-dione |
| SMILES | COc1ccc(OCCCN2C(=O)c3ccccc3C2=O)c(/C=C2\SC(=O)NC2=O)c1 |
| InChI | InChI=1S/C22H18N2O6S/c1-29-14-7-8-17(13(11-14)12-18-19(25)23-22(28)31-18)30-10-4-9-24-20(26)15-5-2-3-6-16(15)21(24)27/h2-3,5-8,11-12H,4,9-10H2,1H3,(H,23,25,28)/b18-12- |
| InChIKey | RVXUHPZBLSVPOP-PDGQHHTCSA-N |
| XLogP | 3.08 |
| TPSA | 102.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.46 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|