C25H26N2O4 — CID 58423785
tert-butyl 6-(3-isocyanophenyl)-4-oxospiro[3H-chromene-2,3'-piperidine]-1'-carboxylate (PubChem CID 58423785) has the molecular formula C25H26N2O4 and a molecular weight of 418.49 g/mol. Its IUPAC name is tert-butyl 6-(3-isocyanophenyl)-4-oxospiro[3H-chromene-2,3'-piperidine]-1'-carboxylate.
| Compound Name | tert-butyl 6-(3-isocyanophenyl)-4-oxospiro[3H-chromene-2,3'-piperidine]-1'-carboxylate |
|---|---|
| PubChem CID | 58423785 |
| Molecular Formula | C25H26N2O4 |
| Molecular Weight | 418.49 g/mol |
| Exact Mass | 418.19 |
| IUPAC Name | tert-butyl 6-(3-isocyanophenyl)-4-oxospiro[3H-chromene-2,3'-piperidine]-1'-carboxylate |
| SMILES | [C-]#[N+]c1cccc(-c2ccc3c(c2)C(=O)CC2(CCCN(C(=O)OC(C)(C)C)C2)O3)c1 |
| InChI | InChI=1S/C25H26N2O4/c1-24(2,3)31-23(29)27-12-6-11-25(16-27)15-21(28)20-14-18(9-10-22(20)30-25)17-7-5-8-19(13-17)26-4/h5,7-10,13-14H,6,11-12,15-16H2,1-3H3 |
| InChIKey | SWXSAKSJYJDELF-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 60.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.49 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|