C24H26F3N3O3 — CID 58423802
3-[3-amino-2-methyl-6'-(2,3,5-trifluorophenyl)spiro[1,2,4-oxadiazole-5,4'-2,3-dihydrochromene]-2'-yl]-5-methylhex-4-en-1-ol (PubChem CID 58423802) has the molecular formula C24H26F3N3O3 and a molecular weight of 461.48 g/mol. Its IUPAC name is 3-[3-amino-2-methyl-6'-(2,3,5-trifluorophenyl)spiro[1,2,4-oxadiazole-5,4'-2,3-dihydrochromene]-2'-yl]-5-methylhex-4-en-1-ol.
| Compound Name | 3-[3-amino-2-methyl-6'-(2,3,5-trifluorophenyl)spiro[1,2,4-oxadiazole-5,4'-2,3-dihydrochromene]-2'-yl]-5-methylhex-4-en-1-ol |
|---|---|
| PubChem CID | 58423802 |
| Molecular Formula | C24H26F3N3O3 |
| Molecular Weight | 461.48 g/mol |
| Exact Mass | 461.19 |
| IUPAC Name | 3-[3-amino-2-methyl-6'-(2,3,5-trifluorophenyl)spiro[1,2,4-oxadiazole-5,4'-2,3-dihydrochromene]-2'-yl]-5-methylhex-4-en-1-ol |
| SMILES | CC(C)=CC(CCO)C1CC2(N=C(N)N(C)O2)c2cc(-c3cc(F)cc(F)c3F)ccc2O1 |
| InChI | InChI=1S/C24H26F3N3O3/c1-13(2)8-15(6-7-31)21-12-24(29-23(28)30(3)33-24)18-9-14(4-5-20(18)32-21)17-10-16(25)11-19(26)22(17)27/h4-5,8-11,15,21,31H,6-7,12H2,1-3H3,(H2,28,29) |
| InChIKey | FKUAIAKGVUFZRF-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 80.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.48 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|