C25H27FN4O3 — CID 58423866
2'-(2,2-dimethyloxan-4-yl)-6'-(2-fluoro-5-isocyanophenyl)-2-methylspiro[1,2,4-oxadiazole-5,4'-2,3-dihydrochromene]-3-amine (PubChem CID 58423866) has the molecular formula C25H27FN4O3 and a molecular weight of 450.51 g/mol. Its IUPAC name is 2'-(2,2-dimethyloxan-4-yl)-6'-(2-fluoro-5-isocyanophenyl)-2-methylspiro[1,2,4-oxadiazole-5,4'-2,3-dihydrochromene]-3-amine.
| Compound Name | 2'-(2,2-dimethyloxan-4-yl)-6'-(2-fluoro-5-isocyanophenyl)-2-methylspiro[1,2,4-oxadiazole-5,4'-2,3-dihydrochromene]-3-amine |
|---|---|
| PubChem CID | 58423866 |
| Molecular Formula | C25H27FN4O3 |
| Molecular Weight | 450.51 g/mol |
| Exact Mass | 450.21 |
| IUPAC Name | 2'-(2,2-dimethyloxan-4-yl)-6'-(2-fluoro-5-isocyanophenyl)-2-methylspiro[1,2,4-oxadiazole-5,4'-2,3-dihydrochromene]-3-amine |
| SMILES | [C-]#[N+]c1ccc(F)c(-c2ccc3c(c2)C2(CC(C4CCOC(C)(C)C4)O3)N=C(N)N(C)O2)c1 |
| InChI | InChI=1S/C25H27FN4O3/c1-24(2)13-16(9-10-31-24)22-14-25(29-23(27)30(4)33-25)19-11-15(5-8-21(19)32-22)18-12-17(28-3)6-7-20(18)26/h5-8,11-12,16,22H,9-10,13-14H2,1-2,4H3,(H2,27,29) |
| InChIKey | RMYAKLFJEHTLOG-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 73.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.51 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|