C26H25N3O — CID 58423884
[6'-(3-isocyanophenyl)spiro[2,3,4,4a,5,6,7,8a-octahydro-1H-naphthalene-8,2'-3H-chromene]-4'-ylidene]cyanamide (PubChem CID 58423884) has the molecular formula C26H25N3O and a molecular weight of 395.51 g/mol. Its IUPAC name is [6'-(3-isocyanophenyl)spiro[2,3,4,4a,5,6,7,8a-octahydro-1H-naphthalene-8,2'-3H-chromene]-4'-ylidene]cyanamide.
| Compound Name | [6'-(3-isocyanophenyl)spiro[2,3,4,4a,5,6,7,8a-octahydro-1H-naphthalene-8,2'-3H-chromene]-4'-ylidene]cyanamide |
|---|---|
| PubChem CID | 58423884 |
| Molecular Formula | C26H25N3O |
| Molecular Weight | 395.51 g/mol |
| Exact Mass | 395.20 |
| IUPAC Name | [6'-(3-isocyanophenyl)spiro[2,3,4,4a,5,6,7,8a-octahydro-1H-naphthalene-8,2'-3H-chromene]-4'-ylidene]cyanamide |
| SMILES | [C-]#[N+]c1cccc(-c2ccc3c(c2)/C(=N\C#N)CC2(CCCC4CCCCC42)O3)c1 |
| InChI | InChI=1S/C26H25N3O/c1-28-21-9-4-7-19(14-21)20-11-12-25-22(15-20)24(29-17-27)16-26(30-25)13-5-8-18-6-2-3-10-23(18)26/h4,7,9,11-12,14-15,18,23H,2-3,5-6,8,10,13,16H2/b29-24- |
| InChIKey | QZTSCEFBQGFFEQ-OLFWJLLRSA-N |
| XLogP | 6.69 |
| TPSA | 49.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.51 |
| LogP ≤ 5 | 6.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|