C28H25F4N3O2 — CID 58423891
6'-[3-fluoro-5-(trifluoromethyl)phenyl]-2-methyl-2'-(1,2,3,4-tetrahydronaphthalen-1-yl)spiro[1,2,4-oxadiazole-5,4'-2,3-dihydrochromene]-3-amine (PubChem CID 58423891) has the molecular formula C28H25F4N3O2 and a molecular weight of 511.52 g/mol. Its IUPAC name is 6'-[3-fluoro-5-(trifluoromethyl)phenyl]-2-methyl-2'-(1,2,3,4-tetrahydronaphthalen-1-yl)spiro[1,2,4-oxadiazole-5,4'-2,3-dihydrochromene]-3-amine.
| Compound Name | 6'-[3-fluoro-5-(trifluoromethyl)phenyl]-2-methyl-2'-(1,2,3,4-tetrahydronaphthalen-1-yl)spiro[1,2,4-oxadiazole-5,4'-2,3-dihydrochromene]-3-amine |
|---|---|
| PubChem CID | 58423891 |
| Molecular Formula | C28H25F4N3O2 |
| Molecular Weight | 511.52 g/mol |
| Exact Mass | 511.19 |
| IUPAC Name | 6'-[3-fluoro-5-(trifluoromethyl)phenyl]-2-methyl-2'-(1,2,3,4-tetrahydronaphthalen-1-yl)spiro[1,2,4-oxadiazole-5,4'-2,3-dihydrochromene]-3-amine |
| SMILES | CN1OC2(CC(C3CCCc4ccccc43)Oc3ccc(-c4cc(F)cc(C(F)(F)F)c4)cc32)N=C1N |
| InChI | InChI=1S/C28H25F4N3O2/c1-35-26(33)34-27(37-35)15-25(22-8-4-6-16-5-2-3-7-21(16)22)36-24-10-9-17(13-23(24)27)18-11-19(28(30,31)32)14-20(29)12-18/h2-3,5,7,9-14,22,25H,4,6,8,15H2,1H3,(H2,33,34) |
| InChIKey | QMUXCVPJIUVUEJ-UHFFFAOYSA-N |
| XLogP | 6.13 |
| TPSA | 60.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.52 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |