C25H28F3N3O3 — CID 58423905
2'-(2,2-dimethyloxan-4-yl)-2-methyl-6'-[3-(trifluoromethyl)phenyl]spiro[1,2,4-oxadiazole-5,4'-2,3-dihydrochromene]-3-amine (PubChem CID 58423905) has the molecular formula C25H28F3N3O3 and a molecular weight of 475.51 g/mol. Its IUPAC name is 2'-(2,2-dimethyloxan-4-yl)-2-methyl-6'-[3-(trifluoromethyl)phenyl]spiro[1,2,4-oxadiazole-5,4'-2,3-dihydrochromene]-3-amine.
| Compound Name | 2'-(2,2-dimethyloxan-4-yl)-2-methyl-6'-[3-(trifluoromethyl)phenyl]spiro[1,2,4-oxadiazole-5,4'-2,3-dihydrochromene]-3-amine |
|---|---|
| PubChem CID | 58423905 |
| Molecular Formula | C25H28F3N3O3 |
| Molecular Weight | 475.51 g/mol |
| Exact Mass | 475.21 |
| IUPAC Name | 2'-(2,2-dimethyloxan-4-yl)-2-methyl-6'-[3-(trifluoromethyl)phenyl]spiro[1,2,4-oxadiazole-5,4'-2,3-dihydrochromene]-3-amine |
| SMILES | CN1OC2(CC(C3CCOC(C)(C)C3)Oc3ccc(-c4cccc(C(F)(F)F)c4)cc32)N=C1N |
| InChI | InChI=1S/C25H28F3N3O3/c1-23(2)13-17(9-10-32-23)21-14-24(30-22(29)31(3)34-24)19-12-16(7-8-20(19)33-21)15-5-4-6-18(11-15)25(26,27)28/h4-8,11-12,17,21H,9-10,13-14H2,1-3H3,(H2,29,30) |
| InChIKey | PRDKTSPDYIMRMU-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 69.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.51 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |