C26H27N5O3 — CID 58423918
5-[3-amino-2'-(2,2-dimethyloxan-4-yl)-2-methylspiro[1,2,4-oxadiazole-5,4'-2,3-dihydrochromene]-6'-yl]benzene-1,3-dicarbonitrile (PubChem CID 58423918) has the molecular formula C26H27N5O3 and a molecular weight of 457.53 g/mol. Its IUPAC name is 5-[3-amino-2'-(2,2-dimethyloxan-4-yl)-2-methylspiro[1,2,4-oxadiazole-5,4'-2,3-dihydrochromene]-6'-yl]benzene-1,3-dicarbonitrile.
| Compound Name | 5-[3-amino-2'-(2,2-dimethyloxan-4-yl)-2-methylspiro[1,2,4-oxadiazole-5,4'-2,3-dihydrochromene]-6'-yl]benzene-1,3-dicarbonitrile |
|---|---|
| PubChem CID | 58423918 |
| Molecular Formula | C26H27N5O3 |
| Molecular Weight | 457.53 g/mol |
| Exact Mass | 457.21 |
| IUPAC Name | 5-[3-amino-2'-(2,2-dimethyloxan-4-yl)-2-methylspiro[1,2,4-oxadiazole-5,4'-2,3-dihydrochromene]-6'-yl]benzene-1,3-dicarbonitrile |
| SMILES | CN1OC2(CC(C3CCOC(C)(C)C3)Oc3ccc(-c4cc(C#N)cc(C#N)c4)cc32)N=C1N |
| InChI | InChI=1S/C26H27N5O3/c1-25(2)12-19(6-7-32-25)23-13-26(30-24(29)31(3)34-26)21-11-18(4-5-22(21)33-23)20-9-16(14-27)8-17(10-20)15-28/h4-5,8-11,19,23H,6-7,12-13H2,1-3H3,(H2,29,30) |
| InChIKey | CKKJKHMGDDKTLP-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 116.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.53 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |