C17H12BrFN2O3 — CID 58423922
6-bromo-2-(3-fluorophenyl)spiro[2,3-dihydrochromene-4,5'-imidazolidine]-2',4'-dione (PubChem CID 58423922) has the molecular formula C17H12BrFN2O3 and a molecular weight of 391.20 g/mol. Its IUPAC name is 6-bromo-2-(3-fluorophenyl)spiro[2,3-dihydrochromene-4,5'-imidazolidine]-2',4'-dione.
| Compound Name | 6-bromo-2-(3-fluorophenyl)spiro[2,3-dihydrochromene-4,5'-imidazolidine]-2',4'-dione |
|---|---|
| PubChem CID | 58423922 |
| Molecular Formula | C17H12BrFN2O3 |
| Molecular Weight | 391.20 g/mol |
| Exact Mass | 390.00 |
| IUPAC Name | 6-bromo-2-(3-fluorophenyl)spiro[2,3-dihydrochromene-4,5'-imidazolidine]-2',4'-dione |
| SMILES | O=C1NC(=O)C2(CC(c3cccc(F)c3)Oc3ccc(Br)cc32)N1 |
| InChI | InChI=1S/C17H12BrFN2O3/c18-10-4-5-13-12(7-10)17(15(22)20-16(23)21-17)8-14(24-13)9-2-1-3-11(19)6-9/h1-7,14H,8H2,(H2,20,21,22,23) |
| InChIKey | AWTNADFUPCWSTM-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.20 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|