C26H27F3N4O3 — CID 58423945
3-[3-amino-2'-(2,2-dimethyloxan-4-yl)-2-methylspiro[1,2,4-oxadiazole-5,4'-2,3-dihydrochromene]-6'-yl]-4-(trifluoromethyl)benzonitrile (PubChem CID 58423945) has the molecular formula C26H27F3N4O3 and a molecular weight of 500.52 g/mol. Its IUPAC name is 3-[3-amino-2'-(2,2-dimethyloxan-4-yl)-2-methylspiro[1,2,4-oxadiazole-5,4'-2,3-dihydrochromene]-6'-yl]-4-(trifluoromethyl)benzonitrile.
| Compound Name | 3-[3-amino-2'-(2,2-dimethyloxan-4-yl)-2-methylspiro[1,2,4-oxadiazole-5,4'-2,3-dihydrochromene]-6'-yl]-4-(trifluoromethyl)benzonitrile |
|---|---|
| PubChem CID | 58423945 |
| Molecular Formula | C26H27F3N4O3 |
| Molecular Weight | 500.52 g/mol |
| Exact Mass | 500.20 |
| IUPAC Name | 3-[3-amino-2'-(2,2-dimethyloxan-4-yl)-2-methylspiro[1,2,4-oxadiazole-5,4'-2,3-dihydrochromene]-6'-yl]-4-(trifluoromethyl)benzonitrile |
| SMILES | CN1OC2(CC(C3CCOC(C)(C)C3)Oc3ccc(-c4cc(C#N)ccc4C(F)(F)F)cc32)N=C1N |
| InChI | InChI=1S/C26H27F3N4O3/c1-24(2)12-17(8-9-34-24)22-13-25(32-23(31)33(3)36-25)20-11-16(5-7-21(20)35-22)18-10-15(14-30)4-6-19(18)26(27,28)29/h4-7,10-11,17,22H,8-9,12-13H2,1-3H3,(H2,31,32) |
| InChIKey | ODRNPDBHUJTTID-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 93.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.52 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |