C28H25FN4O2 — CID 58423964
5-[(2'R,5R)-3-amino-2-methyl-2'-(1,2,3,4-tetrahydronaphthalen-1-yl)spiro[1,2,4-oxadiazole-5,4'-2,3-dihydrochromene]-6'-yl]-2-fluorobenzonitrile (PubChem CID 58423964) has the molecular formula C28H25FN4O2 and a molecular weight of 468.53 g/mol. Its IUPAC name is 5-[(2'R,5R)-3-amino-2-methyl-2'-(1,2,3,4-tetrahydronaphthalen-1-yl)spiro[1,2,4-oxadiazole-5,4'-2,3-dihydrochromene]-6'-yl]-2-fluorobenzonitrile.
| Compound Name | 5-[(2'R,5R)-3-amino-2-methyl-2'-(1,2,3,4-tetrahydronaphthalen-1-yl)spiro[1,2,4-oxadiazole-5,4'-2,3-dihydrochromene]-6'-yl]-2-fluorobenzonitrile |
|---|---|
| PubChem CID | 58423964 |
| Molecular Formula | C28H25FN4O2 |
| Molecular Weight | 468.53 g/mol |
| Exact Mass | 468.20 |
| IUPAC Name | 5-[(2'R,5R)-3-amino-2-methyl-2'-(1,2,3,4-tetrahydronaphthalen-1-yl)spiro[1,2,4-oxadiazole-5,4'-2,3-dihydrochromene]-6'-yl]-2-fluorobenzonitrile |
| SMILES | CN1O[C@@]2(C[C@H](C3CCCc4ccccc43)Oc3ccc(-c4ccc(F)c(C#N)c4)cc32)N=C1N |
| InChI | InChI=1S/C28H25FN4O2/c1-33-27(31)32-28(35-33)15-26(22-8-4-6-17-5-2-3-7-21(17)22)34-25-12-10-19(14-23(25)28)18-9-11-24(29)20(13-18)16-30/h2-3,5,7,9-14,22,26H,4,6,8,15H2,1H3,(H2,31,32)/t22?,26-,28-/m1/s1 |
| InChIKey | GVXMFCXRJZXRTQ-QNWZRYLWSA-N |
| XLogP | 4.98 |
| TPSA | 83.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.53 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |