C24H27F2N3O3 — CID 58424033
6'-(3,5-difluorophenyl)-2'-(2,2-dimethyloxan-4-yl)-2-methylspiro[1,2,4-oxadiazole-5,4'-2,3-dihydrochromene]-3-amine (PubChem CID 58424033) has the molecular formula C24H27F2N3O3 and a molecular weight of 443.49 g/mol. Its IUPAC name is 6'-(3,5-difluorophenyl)-2'-(2,2-dimethyloxan-4-yl)-2-methylspiro[1,2,4-oxadiazole-5,4'-2,3-dihydrochromene]-3-amine.
| Compound Name | 6'-(3,5-difluorophenyl)-2'-(2,2-dimethyloxan-4-yl)-2-methylspiro[1,2,4-oxadiazole-5,4'-2,3-dihydrochromene]-3-amine |
|---|---|
| PubChem CID | 58424033 |
| Molecular Formula | C24H27F2N3O3 |
| Molecular Weight | 443.49 g/mol |
| Exact Mass | 443.20 |
| IUPAC Name | 6'-(3,5-difluorophenyl)-2'-(2,2-dimethyloxan-4-yl)-2-methylspiro[1,2,4-oxadiazole-5,4'-2,3-dihydrochromene]-3-amine |
| SMILES | CN1OC2(CC(C3CCOC(C)(C)C3)Oc3ccc(-c4cc(F)cc(F)c4)cc32)N=C1N |
| InChI | InChI=1S/C24H27F2N3O3/c1-23(2)12-15(6-7-30-23)21-13-24(28-22(27)29(3)32-24)19-10-14(4-5-20(19)31-21)16-8-17(25)11-18(26)9-16/h4-5,8-11,15,21H,6-7,12-13H2,1-3H3,(H2,27,28) |
| InChIKey | MXNHKJGRTBVBIZ-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 69.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.49 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |