C13H13BN2O2 — CID 58424098
2-(5,5-dimethyl-1,3,2-dioxaborinan-2-yl)-4-isocyanobenzonitrile (PubChem CID 58424098) has the molecular formula C13H13BN2O2 and a molecular weight of 240.07 g/mol. Its IUPAC name is 2-(5,5-dimethyl-1,3,2-dioxaborinan-2-yl)-4-isocyanobenzonitrile.
| Compound Name | 2-(5,5-dimethyl-1,3,2-dioxaborinan-2-yl)-4-isocyanobenzonitrile |
|---|---|
| PubChem CID | 58424098 |
| Molecular Formula | C13H13BN2O2 |
| Molecular Weight | 240.07 g/mol |
| Exact Mass | 240.11 |
| IUPAC Name | 2-(5,5-dimethyl-1,3,2-dioxaborinan-2-yl)-4-isocyanobenzonitrile |
| SMILES | [C-]#[N+]c1ccc(C#N)c(B2OCC(C)(C)CO2)c1 |
| InChI | InChI=1S/C13H13BN2O2/c1-13(2)8-17-14(18-9-13)12-6-11(16-3)5-4-10(12)7-15/h4-6H,8-9H2,1-2H3 |
| InChIKey | ZUXJCAOJBZVJMJ-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.07 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|