C17H11BrF2N2O3 — CID 58424173
6-bromo-2-(2,3-difluorophenyl)spiro[2,3-dihydrochromene-4,5'-imidazolidine]-2',4'-dione (PubChem CID 58424173) has the molecular formula C17H11BrF2N2O3 and a molecular weight of 409.19 g/mol. Its IUPAC name is 6-bromo-2-(2,3-difluorophenyl)spiro[2,3-dihydrochromene-4,5'-imidazolidine]-2',4'-dione.
| Compound Name | 6-bromo-2-(2,3-difluorophenyl)spiro[2,3-dihydrochromene-4,5'-imidazolidine]-2',4'-dione |
|---|---|
| PubChem CID | 58424173 |
| Molecular Formula | C17H11BrF2N2O3 |
| Molecular Weight | 409.19 g/mol |
| Exact Mass | 407.99 |
| IUPAC Name | 6-bromo-2-(2,3-difluorophenyl)spiro[2,3-dihydrochromene-4,5'-imidazolidine]-2',4'-dione |
| SMILES | O=C1NC(=O)C2(CC(c3cccc(F)c3F)Oc3ccc(Br)cc32)N1 |
| InChI | InChI=1S/C17H11BrF2N2O3/c18-8-4-5-12-10(6-8)17(15(23)21-16(24)22-17)7-13(25-12)9-2-1-3-11(19)14(9)20/h1-6,13H,7H2,(H2,21,22,23,24) |
| InChIKey | HOVPTCVHPIMYJP-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.19 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|