C25H27FN4O3 — CID 58424265
3-[3-amino-2'-(2,2-dimethyloxan-4-yl)-2-methylspiro[1,2,4-oxadiazole-5,4'-2,3-dihydrochromene]-6'-yl]-4-fluorobenzonitrile (PubChem CID 58424265) has the molecular formula C25H27FN4O3 and a molecular weight of 450.51 g/mol. Its IUPAC name is 3-[3-amino-2'-(2,2-dimethyloxan-4-yl)-2-methylspiro[1,2,4-oxadiazole-5,4'-2,3-dihydrochromene]-6'-yl]-4-fluorobenzonitrile.
| Compound Name | 3-[3-amino-2'-(2,2-dimethyloxan-4-yl)-2-methylspiro[1,2,4-oxadiazole-5,4'-2,3-dihydrochromene]-6'-yl]-4-fluorobenzonitrile |
|---|---|
| PubChem CID | 58424265 |
| Molecular Formula | C25H27FN4O3 |
| Molecular Weight | 450.51 g/mol |
| Exact Mass | 450.21 |
| IUPAC Name | 3-[3-amino-2'-(2,2-dimethyloxan-4-yl)-2-methylspiro[1,2,4-oxadiazole-5,4'-2,3-dihydrochromene]-6'-yl]-4-fluorobenzonitrile |
| SMILES | CN1OC2(CC(C3CCOC(C)(C)C3)Oc3ccc(-c4cc(C#N)ccc4F)cc32)N=C1N |
| InChI | InChI=1S/C25H27FN4O3/c1-24(2)12-17(8-9-31-24)22-13-25(29-23(28)30(3)33-25)19-11-16(5-7-21(19)32-22)18-10-15(14-27)4-6-20(18)26/h4-7,10-11,17,22H,8-9,12-13H2,1-3H3,(H2,28,29) |
| InChIKey | RWEBSLYKFMRMDD-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 93.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.51 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |