About (6-hydroxy-2-phenyl-2,3-dihydrochromen-4-ylidene)cyanamide
(6-hydroxy-2-phenyl-2,3-dihydrochromen-4-ylidene)cyanamide (PubChem CID 58424361) has the molecular formula C16H12N2O2
and a molecular weight of 264.28 g/mol. Its IUPAC name is (6-hydroxy-2-phenyl-2,3-dihydrochromen-4-ylidene)cyanamide.
Molecular Properties
| Compound Name | (6-hydroxy-2-phenyl-2,3-dihydrochromen-4-ylidene)cyanamide |
| PubChem CID | 58424361 |
| Molecular Formula | C16H12N2O2 |
| Molecular Weight | 264.28 g/mol |
| Exact Mass | 264.09 |
| IUPAC Name | (6-hydroxy-2-phenyl-2,3-dihydrochromen-4-ylidene)cyanamide |
| SMILES | N#C/N=C1\CC(c2ccccc2)Oc2ccc(O)cc21 |
| InChI | InChI=1S/C16H12N2O2/c17-10-18-14-9-16(11-4-2-1-3-5-11)20-15-7-6-12(19)8-13(14)15/h1-8,16,19H,9H2/b18-14+ |
| InChIKey | YXTMBCCARZXTBV-NBVRZTHBSA-N |
| XLogP | 3.19 |
| TPSA | 65.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 264.28 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze (6-hydroxy-2-phenyl-2,3-dihydrochromen-4-ylidene)cyanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (6-hydroxy-2-phenyl-2,3-dihydrochromen-4-ylidene)cyanamide?
The IUPAC name of (6-hydroxy-2-phenyl-2,3-dihydrochromen-4-ylidene)cyanamide (CID 58424361) is (6-hydroxy-2-phenyl-2,3-dihydrochromen-4-ylidene)cyanamide.
What is the SMILES notation for (6-hydroxy-2-phenyl-2,3-dihydrochromen-4-ylidene)cyanamide?
The canonical SMILES for (6-hydroxy-2-phenyl-2,3-dihydrochromen-4-ylidene)cyanamide is N#C/N=C1\CC(c2ccccc2)Oc2ccc(O)cc21.
What is the InChIKey of (6-hydroxy-2-phenyl-2,3-dihydrochromen-4-ylidene)cyanamide?
The InChIKey is YXTMBCCARZXTBV-NBVRZTHBSA-N. The full InChI is InChI=1S/C16H12N2O2/c17-10-18-14-9-16(11-4-2-1-3-5-11)20-15-7-6-12(19)8-13(14)15/h1-8,16,19H,9H2/b18-14+.
What are the key properties of (6-hydroxy-2-phenyl-2,3-dihydrochromen-4-ylidene)cyanamide?
(6-hydroxy-2-phenyl-2,3-dihydrochromen-4-ylidene)cyanamide has a molecular weight of 264.28 g/mol, XLogP of 3.19, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (6-hydroxy-2-phenyl-2,3-dihydrochromen-4-ylidene)cyanamide is sourced from PubChem (CID 58424361), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).