C24H19FN4O2 — CID 58424363
6'-(4-fluoro-3-isocyanophenyl)-2-methyl-2'-phenylspiro[1,2,4-oxadiazole-5,4'-2,3-dihydrochromene]-3-amine (PubChem CID 58424363) has the molecular formula C24H19FN4O2 and a molecular weight of 414.44 g/mol. Its IUPAC name is 6'-(4-fluoro-3-isocyanophenyl)-2-methyl-2'-phenylspiro[1,2,4-oxadiazole-5,4'-2,3-dihydrochromene]-3-amine.
| Compound Name | 6'-(4-fluoro-3-isocyanophenyl)-2-methyl-2'-phenylspiro[1,2,4-oxadiazole-5,4'-2,3-dihydrochromene]-3-amine |
|---|---|
| PubChem CID | 58424363 |
| Molecular Formula | C24H19FN4O2 |
| Molecular Weight | 414.44 g/mol |
| Exact Mass | 414.15 |
| IUPAC Name | 6'-(4-fluoro-3-isocyanophenyl)-2-methyl-2'-phenylspiro[1,2,4-oxadiazole-5,4'-2,3-dihydrochromene]-3-amine |
| SMILES | [C-]#[N+]c1cc(-c2ccc3c(c2)C2(CC(c4ccccc4)O3)N=C(N)N(C)O2)ccc1F |
| InChI | InChI=1S/C24H19FN4O2/c1-27-20-13-17(8-10-19(20)25)16-9-11-21-18(12-16)24(28-23(26)29(2)31-24)14-22(30-21)15-6-4-3-5-7-15/h3-13,22H,14H2,2H3,(H2,26,28) |
| InChIKey | UDJIHLLFDXVGTI-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 64.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.44 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|