About 4-prop-1-en-2-ylphenol
4-prop-1-en-2-ylphenol (PubChem CID 584247) has the molecular formula C9H10O
and a molecular weight of 134.18 g/mol. Its IUPAC name is 4-prop-1-en-2-ylphenol.
Molecular Properties
| Compound Name | 4-prop-1-en-2-ylphenol |
| PubChem CID | 584247 |
| Molecular Formula | C9H10O |
| Molecular Weight | 134.18 g/mol |
| Exact Mass | 134.07 |
| IUPAC Name | 4-prop-1-en-2-ylphenol |
| SMILES | C=C(C)c1ccc(O)cc1 |
| InChI | InChI=1S/C9H10O/c1-7(2)8-3-5-9(10)6-4-8/h3-6,10H,1H2,2H3 |
| InChIKey | JAGRUUPXPPLSRX-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 134.18 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 4-prop-1-en-2-ylphenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-prop-1-en-2-ylphenol?
The IUPAC name of 4-prop-1-en-2-ylphenol (CID 584247) is 4-prop-1-en-2-ylphenol.
What is the SMILES notation for 4-prop-1-en-2-ylphenol?
The canonical SMILES for 4-prop-1-en-2-ylphenol is C=C(C)c1ccc(O)cc1.
What is the InChIKey of 4-prop-1-en-2-ylphenol?
The InChIKey is JAGRUUPXPPLSRX-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10O/c1-7(2)8-3-5-9(10)6-4-8/h3-6,10H,1H2,2H3.
What are the key properties of 4-prop-1-en-2-ylphenol?
4-prop-1-en-2-ylphenol has a molecular weight of 134.18 g/mol, XLogP of 2.43, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-prop-1-en-2-ylphenol is sourced from PubChem (CID 584247), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).