About CID 58424755
CID 58424755 (PubChem CID 58424755) has the molecular formula C22H20F2N4O3
and a molecular weight of 426.42 g/mol.
Molecular Properties
| Compound Name | CID 58424755 |
| PubChem CID | 58424755 |
| Molecular Formula | C22H20F2N4O3 |
| Molecular Weight | 426.42 g/mol |
| Exact Mass | 426.15 |
| IUPAC Name | — |
| SMILES | CN1OC2(N=C1N)c1cc(-c3cccc(C#N)c3)ccc1OC1(CCCOC1)C2(F)F |
| InChI | InChI=1S/C22H20F2N4O3/c1-28-19(26)27-21(31-28)17-11-16(15-5-2-4-14(10-15)12-25)6-7-18(17)30-20(22(21,23)24)8-3-9-29-13-20/h2,4-7,10-11H,3,8-9,13H2,1H3,(H2,26,27) |
| InChIKey | MGHJLZGHJVIWEX-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 93.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 426.42 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze CID 58424755 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 58424755?
The IUPAC name of CID 58424755 (CID 58424755) is not available.
What is the SMILES notation for CID 58424755?
The canonical SMILES for CID 58424755 is CN1OC2(N=C1N)c1cc(-c3cccc(C#N)c3)ccc1OC1(CCCOC1)C2(F)F.
What is the InChIKey of CID 58424755?
The InChIKey is MGHJLZGHJVIWEX-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H20F2N4O3/c1-28-19(26)27-21(31-28)17-11-16(15-5-2-4-14(10-15)12-25)6-7-18(17)30-20(22(21,23)24)8-3-9-29-13-20/h2,4-7,10-11H,3,8-9,13H2,1H3,(H2,26,27).
What are the key properties of CID 58424755?
CID 58424755 has a molecular weight of 426.42 g/mol, XLogP of 3.15, 1 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for CID 58424755 is sourced from PubChem (CID 58424755), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).