C21H29N3O2 — CID 58424941
9-(4-piperidin-1-ylbutoxy)-2,3,4,6-tetrahydro-1H-benzo[h][1,6]naphthyridin-5-one (PubChem CID 58424941) has the molecular formula C21H29N3O2 and a molecular weight of 355.48 g/mol. Its IUPAC name is 9-(4-piperidin-1-ylbutoxy)-2,3,4,6-tetrahydro-1H-benzo[h][1,6]naphthyridin-5-one.
| Compound Name | 9-(4-piperidin-1-ylbutoxy)-2,3,4,6-tetrahydro-1H-benzo[h][1,6]naphthyridin-5-one |
|---|---|
| PubChem CID | 58424941 |
| Molecular Formula | C21H29N3O2 |
| Molecular Weight | 355.48 g/mol |
| Exact Mass | 355.23 |
| IUPAC Name | 9-(4-piperidin-1-ylbutoxy)-2,3,4,6-tetrahydro-1H-benzo[h][1,6]naphthyridin-5-one |
| SMILES | O=c1[nH]c2ccc(OCCCCN3CCCCC3)cc2c2c1CCCN2 |
| InChI | InChI=1S/C21H29N3O2/c25-21-17-7-6-10-22-20(17)18-15-16(8-9-19(18)23-21)26-14-5-4-13-24-11-2-1-3-12-24/h8-9,15,22H,1-7,10-14H2,(H,23,25) |
| InChIKey | RAEGOSFNXPZLSV-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 57.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.48 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|