About (4S)-6-imino-1,4-dimethyl-4-[3-(3-prop-2-enoxyphenyl)phenyl]piperidin-2-one
(4S)-6-imino-1,4-dimethyl-4-[3-(3-prop-2-enoxyphenyl)phenyl]piperidin-2-one (PubChem CID 58425124) has the molecular formula C22H24N2O2
and a molecular weight of 348.45 g/mol. Its IUPAC name is (4S)-6-imino-1,4-dimethyl-4-[3-(3-prop-2-enoxyphenyl)phenyl]piperidin-2-one.
Molecular Properties
| Compound Name | (4S)-6-imino-1,4-dimethyl-4-[3-(3-prop-2-enoxyphenyl)phenyl]piperidin-2-one |
| PubChem CID | 58425124 |
| Molecular Formula | C22H24N2O2 |
| Molecular Weight | 348.45 g/mol |
| Exact Mass | 348.18 |
| IUPAC Name | (4S)-6-imino-1,4-dimethyl-4-[3-(3-prop-2-enoxyphenyl)phenyl]piperidin-2-one |
| SMILES | [H]/N=C1\C[C@](C)(c2cccc(-c3cccc(OCC=C)c3)c2)CC(=O)N1C |
| InChI | InChI=1S/C22H24N2O2/c1-4-11-26-19-10-6-8-17(13-19)16-7-5-9-18(12-16)22(2)14-20(23)24(3)21(25)15-22/h4-10,12-13,23H,1,11,14-15H2,2-3H3/b23-20+/t22-/m0/s1 |
| InChIKey | QBXJAZPPZJRMRN-HFEWCJDKSA-N |
| XLogP | 4.41 |
| TPSA | 53.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 348.45 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (4S)-6-imino-1,4-dimethyl-4-[3-(3-prop-2-enoxyphenyl)phenyl]piperidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4S)-6-imino-1,4-dimethyl-4-[3-(3-prop-2-enoxyphenyl)phenyl]piperidin-2-one?
The IUPAC name of (4S)-6-imino-1,4-dimethyl-4-[3-(3-prop-2-enoxyphenyl)phenyl]piperidin-2-one (CID 58425124) is (4S)-6-imino-1,4-dimethyl-4-[3-(3-prop-2-enoxyphenyl)phenyl]piperidin-2-one.
What is the SMILES notation for (4S)-6-imino-1,4-dimethyl-4-[3-(3-prop-2-enoxyphenyl)phenyl]piperidin-2-one?
The canonical SMILES for (4S)-6-imino-1,4-dimethyl-4-[3-(3-prop-2-enoxyphenyl)phenyl]piperidin-2-one is [H]/N=C1\C[C@](C)(c2cccc(-c3cccc(OCC=C)c3)c2)CC(=O)N1C.
What is the InChIKey of (4S)-6-imino-1,4-dimethyl-4-[3-(3-prop-2-enoxyphenyl)phenyl]piperidin-2-one?
The InChIKey is QBXJAZPPZJRMRN-HFEWCJDKSA-N. The full InChI is InChI=1S/C22H24N2O2/c1-4-11-26-19-10-6-8-17(13-19)16-7-5-9-18(12-16)22(2)14-20(23)24(3)21(25)15-22/h4-10,12-13,23H,1,11,14-15H2,2-3H3/b23-20+/t22-/m0/s1.
What are the key properties of (4S)-6-imino-1,4-dimethyl-4-[3-(3-prop-2-enoxyphenyl)phenyl]piperidin-2-one?
(4S)-6-imino-1,4-dimethyl-4-[3-(3-prop-2-enoxyphenyl)phenyl]piperidin-2-one has a molecular weight of 348.45 g/mol, XLogP of 4.41, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (4S)-6-imino-1,4-dimethyl-4-[3-(3-prop-2-enoxyphenyl)phenyl]piperidin-2-one is sourced from PubChem (CID 58425124), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).